CymitQuimica logo

CAS 112970-67-9

:

1H-Indole, 4-methoxy-1-[(4-methylphenyl)sulfonyl]-

Description:
1H-Indole, 4-methoxy-1-[(4-methylphenyl)sulfonyl]- is a chemical compound characterized by its indole core structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methoxy group at the 4-position of the indole enhances its solubility and can influence its reactivity. Additionally, the sulfonyl group attached to a 4-methylphenyl moiety introduces significant polar characteristics, which can affect the compound's interaction with biological systems and its overall pharmacological properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in fields such as organic synthesis and pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. The compound's stability, solubility, and reactivity are influenced by the functional groups present, which can also play a role in its mechanism of action in biological contexts.
Formula:C16H15NO3S
InChI:InChI=1S/C16H15NO3S/c1-12-6-8-13(9-7-12)21(18,19)17-11-10-14-15(17)4-3-5-16(14)20-2/h3-11H,1-2H3
InChI key:AAAVYQGZECVTEO-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C=CC=C3OC
Found 2 products.