CAS 113-73-5
:Gramicidin S
Description:
Gramicidin S is a cyclic peptide antibiotic that is primarily produced by the bacterium Bacillus brevis. It is composed of a sequence of amino acids that form a cyclic structure, which contributes to its stability and biological activity. Gramicidin S exhibits broad-spectrum antibacterial properties, particularly effective against Gram-positive bacteria, and is often used in topical formulations for treating infections. The compound operates by disrupting bacterial cell membrane integrity, leading to cell lysis. It is characterized by its solubility in organic solvents and limited solubility in water, which influences its formulation in pharmaceutical applications. Gramicidin S is also known for its low toxicity to human cells, making it a valuable option in clinical settings. Additionally, it has been studied for its potential use in various biotechnological applications due to its unique structural properties. Overall, Gramicidin S is an important antibiotic with significant relevance in both medical and research fields.
Formula:C60H92N12O10
InChI:InChI=1/C60H92N12O10/c1-35(2)31-43-53(75)67-45(33-39-19-11-9-12-20-39)59(81)71-29-17-25-47(71)55(77)70-50(38(7)8)58(80)64-42(24-16-28-62)52(74)66-44(32-36(3)4)54(76)68-46(34-40-21-13-10-14-22-40)60(82)72-30-18-26-48(72)56(78)69-49(37(5)6)57(79)63-41(23-15-27-61)51(73)65-43/h9-14,19-22,35-38,41-50H,15-18,23-34,61-62H2,1-8H3,(H,63,79)(H,64,80)(H,65,73)(H,66,74)(H,67,75)(H,68,76)(H,69,78)(H,70,77)/t41-,42-,43-,44-,45+,46+,47-,48-,49-,50-/m0/s1
Synonyms:- Brn 0605227
- Gramacidine S
- Gramacidine S [INN-French]
- Gramicidin C
- Gramicidina S
- Gramicidina S [INN-Spanish]
- Gramicidinum S
- Gramicidinum S [INN-Latin]
- Gramicin S 1
- Gramicin S-A
- Cyclo(L-valyl-L-ornithyl-L-leucyl-D-phenylalanyl-L-prolyl-L-valyl-L-ornithyl-L-leucyl-D-phenylalanyl-L-prolyl)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Gramicidin S
CAS:<p>Gramicidin S (Gramicidin Soviet), a cationic cyclic peptide antibiotic, disrupts the membrane integrity of both Gram-positive and Gram-negative bacteria and</p>Formula:C60H92N12O10Purity:98%Color and Shape:SolidMolecular weight:1141.45Gramicidin S TFA salt
CAS:<p>Gramicidin S TFA salt is a cyclic peptide antibiotic, which is originally derived from the soil bacterium Bacillus brevis. Its mode of action involves disrupting bacterial cell membranes by integrating into the lipid bilayer, which affects membrane integrity and leads to cell lysis. The unique cyclic dodecapeptide structure allows Gramicidin S to interact specifically with membrane lipids, forming pores that increase permeability and ion flux.In terms of applications, Gramicidin S is primarily used in research settings for studying membrane dynamics and permeability. Its potent antibiotic activity makes it a valuable compound in bacteriological studies, particularly for investigating multi-drug resistance mechanisms and testing novel antimicrobial strategies. Additionally, due to its peptide nature, it serves as a model compound for the design of synthetic analogs aimed at overcoming bacterial resistance.</p>Formula:C60H92N12O10(freebase)Purity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:1,141.45 g/mol



