CymitQuimica logo

CAS 1130-95-6

:

3-(2-Fluorophenyl)-2-butenoic acid

Description:
3-(2-Fluorophenyl)-2-butenoic acid, with the CAS number 1130-95-6, is an organic compound characterized by its unique structure, which includes a butenoic acid moiety and a fluorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, making it more reactive in certain chemical reactions compared to its non-fluorinated counterparts. Additionally, the butenoic acid functional group imparts acidity, allowing for potential interactions in various chemical environments. This compound may be of interest in pharmaceutical research and development due to its structural features, which could lead to the synthesis of biologically active molecules. Its solubility, stability, and reactivity can vary depending on the solvent and conditions used, making it a versatile compound in synthetic organic chemistry.
Formula:C10H9FO2
InChI:InChI=1S/C10H9FO2/c1-7(6-10(12)13)8-4-2-3-5-9(8)11/h2-6H,1H3,(H,12,13)
InChI key:InChIKey=XXKVFOSJPHPHOZ-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)(C)C1=C(F)C=CC=C1
Synonyms:
  • Cinnamic acid, o-fluoro-β-methyl-
  • Cinnamic acid, o-fluoro-β-methyl-, cis-
  • 3-(2-Fluorophenyl)-2-butenoic acid
  • 2-Butenoic acid, 3-(2-fluorophenyl)-
Found 1 products.