CymitQuimica logo

CAS 113003-49-9

:

ALPHA-CHLORO-9-ANTHRALDOXIME

Description:
Alpha-chloro-9-anthraldoxime is a chemical compound characterized by its unique structure, which includes an anthraldoxime moiety with a chlorine substituent at the alpha position. This compound typically appears as a solid and is known for its potential applications in organic synthesis and as a reagent in various chemical reactions. Its molecular structure contributes to its reactivity, particularly in nucleophilic substitution reactions due to the presence of the electrophilic chlorine atom. The compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Additionally, alpha-chloro-9-anthraldoxime may possess biological activity, making it of interest in medicinal chemistry. Safety data sheets should be consulted for handling and storage guidelines, as the compound may pose hazards typical of chlorinated organic compounds, including potential toxicity and environmental impact. Overall, its unique properties make it a subject of interest in both academic and industrial research settings.
Formula:C15H10ClNO
InChI:InChI=1/C15H10ClNO/c16-15(17-18)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,18H/b17-15+
InChI key:HNCKUONLZVGZKH-BMRADRMJSA-N
SMILES:C1=CC=C2C(=C1)C=C3C=CC=CC3=C2/C(=N\O)/Cl
Synonyms:
  • -Chloro-9-anthraldoxime
  • A-Chloro-9-Anthraldoxime
  • N-hydroxyanthracene-9-carboximidoyl chloride
Found 3 products.