CymitQuimica logo

CAS 1130156-23-8

:

tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate

Description:
Tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate is a chemical compound characterized by its piperidine ring structure, which includes a hydroxyl group and a carbonyl group, contributing to its reactivity and potential applications in organic synthesis. The tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents, while the carboxylate moiety can participate in various chemical reactions, such as esterification and nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features suggest that it could serve as a building block for more complex molecules. Additionally, the presence of functional groups like the hydroxyl and carbonyl can influence its physical properties, such as boiling point and melting point, as well as its interaction with other chemical species. Overall, tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate is a versatile compound with potential applications in various fields, including drug development and synthetic chemistry.
Formula:C10H17NO4
InChI:InChI=1S/C10H17NO4/c1-10(2,3)15-9(14)11-5-4-7(12)8(13)6-11/h8,13H,4-6H2,1-3H3
InChI key:QDLQOXCJAGFXNE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(=O)C(C1)O
Found 4 products.