CymitQuimica logo

CAS 113030-24-3

:

2-Amino-4,7-dihydro-6(5H)-benzothiazolone

Description:
2-Amino-4,7-dihydro-6(5H)-benzothiazolone is an organic compound characterized by its unique bicyclic structure, which includes both a benzothiazole moiety and an amino group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino group. It is known for its applications in various fields, including pharmaceuticals and materials science, often serving as an intermediate in the synthesis of more complex molecules. The presence of the benzothiazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns typical of benzothiazoles, such as nucleophilic substitution or electrophilic aromatic substitution, depending on the functional groups present. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, 2-Amino-4,7-dihydro-6(5H)-benzothiazolone is a versatile compound with significant implications in chemical research and application.
Formula:C7H8N2OS
InChI:InChI=1/C7H8N2OS/c8-7-9-5-2-1-4(10)3-6(5)11-7/h1-3H2,(H2,8,9)
InChI key:InChIKey=WIYDBHSVURZSJV-UHFFFAOYSA-N
SMILES:NC1=NC2=C(S1)CC(=O)CC2
Synonyms:
  • 2-Amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-one
  • 2-Amino-4,5-dihydrobenzo[d]thiazol-6(7H)-one
  • 2-Amino-4,7-dihydro-6(5H)-benzothiazolone
  • 2-Amino-5,7-dihydro-4H-1,3-benzothiazol-6-one
  • 2-Amino-6-oxo-4,5,6,7-tetrahydrobenzothiazole
  • 6(5H)-benzothiazolone, 2-amino-4,7-dihydro-
  • 2-Amino-4,7-dihydro-1,3-benzothiazol-6(5H)-one
  • 2-Amino-4,7-dihydro-5H-benzothiazol-6-one
Found 5 products.