CymitQuimica logo

CAS 1130309-70-4

:

1H-Pyrazolo[4,3-b]pyridine, 7-Methyl-

Description:
1H-Pyrazolo[4,3-b]pyridine, 7-Methyl- is a heterocyclic organic compound characterized by a fused pyrazole and pyridine ring system. This compound features a methyl group at the 7-position of the pyrazolo ring, which can influence its chemical reactivity and biological activity. Typically, compounds of this class exhibit a range of properties, including potential pharmacological activities, making them of interest in medicinal chemistry. The presence of nitrogen atoms in the ring structure contributes to its basicity and potential for forming coordination complexes with metals. Additionally, the compound may exhibit solubility in polar organic solvents, which is common for nitrogen-containing heterocycles. Its unique structure allows for various substitution patterns, which can be explored for developing derivatives with enhanced properties. As with many heterocycles, it may also participate in various chemical reactions, such as electrophilic aromatic substitution or nucleophilic attack, depending on the functional groups present. Overall, 1H-Pyrazolo[4,3-b]pyridine, 7-Methyl- is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H7N3
InChI:InChI=1S/C7H7N3/c1-5-2-3-8-6-4-9-10-7(5)6/h2-4H,1H3,(H,9,10)
InChI key:MFQZVNXIXXFCKR-UHFFFAOYSA-N
SMILES:CC1=C2C(=NC=C1)C=NN2
Found 2 products.