
CAS 113036-79-6
:(S)-2-Amino-N-[[[(5S)-6,7,9,10,13,14,14aα,15-octahydro-1,4-dihydroxy-2,5α,11-trimethoxy-3,12,16-trimethyl-10,13-dioxo-6α,15α-epimino-5H-isoquino[3,2-b][3]benzazocin]-9β-yl]methyl]propionamide
Description:
(S)-2-Amino-N-[[[(5S)-6,7,9,10,13,14,14aα,15-octahydro-1,4-dihydroxy-2,5α,11-trimethoxy-3,12,16-trimethyl-10,13-dioxo-6α,15α-epimino-5H-isoquino[3,2-b][3]benzazocin]-9β-yl]methyl]propionamide, with CAS number 113036-79-6, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amino, hydroxyl, and methoxy groups. This compound exhibits chirality, indicated by the (S) configuration, which can influence its biological activity and interactions. The presence of a bicyclic isoquinoline framework contributes to its potential pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary significantly based on its structural features, including the stereochemistry and the arrangement of substituents. Its potential applications may include roles in drug development or as a biochemical probe, although specific biological activities would require further investigation through experimental studies. Overall, this substance exemplifies the complexity often found in bioactive molecules, highlighting the interplay between structure and function in chemical compounds.
Formula:C29H38N4O8
InChI:InChI=1S/C29H38N4O8/c1-11-22(34)14-8-15-21-19-20(23(35)12(2)27(40-6)25(19)37)28(41-7)17(32(21)4)10-33(15)16(9-31-29(38)13(3)30)18(14)24(36)26(11)39-5/h13,15-17,21,28,35,37H,8-10,30H2,1-7H3,(H,31,38)/t13-,15-,16-,17+,21-,28+/m0/s1
InChI key:UFWYPWFCNWILJC-KTHBZOPUSA-N
SMILES:CC1=C(C2=C([C@@H]3[C@@H]4CC5=C([C@@H](N4C[C@H]([C@H]2OC)N3C)CNC(=O)[C@H](C)N)C(=O)C(=C(C5=O)C)OC)C(=C1OC)O)O
Synonyms:- Saframycin Mx-2
- Propanamide, 2-amino-N-[[(5S,6R,9R,14aS,15R)-6,7,9,10,13,14,14a,15-octahydro-1,4-dihydroxy-2,5,11-trimethoxy-3,12,16-trimethyl-10,13-dioxo-6,15-imino-5H-isoquino[3,2-b][3]benzazocin-9-yl]methyl]-, (2S)-
- (S)-2-Amino-N-[[[(5S)-6,7,9,10,13,14,14aα,15-octahydro-1,4-dihydroxy-2,5α,11-trimethoxy-3,12,16-trimethyl-10,13-dioxo-6α,15α-epimino-5H-isoquino[3,2-b][3]benzazocin]-9β-yl]methyl]propionamide
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Saframycin Mx2
CAS:Saframycin Mx2 exhibits activity against both Gram-positive and Gram-negative bacteria.Formula:C29H38N4O8Color and Shape:SolidMolecular weight:570.634
