CymitQuimica logo

CAS 113048-68-3

:

3-Trifluoromethylcinnamic acid ethyl ester

Description:
3-Trifluoromethylcinnamic acid ethyl ester is an organic compound characterized by its unique structure, which includes a trifluoromethyl group and an ethyl ester functional group attached to a cinnamic acid backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility and solubility in organic solvents. The presence of the trifluoromethyl group enhances its lipophilicity and may impart distinctive electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Its molecular structure contributes to its potential reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 3-Trifluoromethylcinnamic acid ethyl ester represents a valuable compound in organic synthesis and materials science.
Formula:C12H11F3O2
InChI:InChI=1/C12H11F3O2/c1-2-17-11(16)7-6-9-4-3-5-10(8-9)12(13,14)15/h3-8H,2H2,1H3/b7-6+
InChI key:RAEFFHZPTOFBED-VOTSOKGWSA-N
SMILES:CCOC(=O)/C=C/C1=CC(=CC=C1)C(F)(F)F
Synonyms:
  • ethyl (2E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate
Found 4 products.