CymitQuimica logo

CAS 113092-96-9

:

6-Bromo-2-chloro-3-methylquinoline

Description:
6-Bromo-2-chloro-3-methylquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 6 and 2 positions, respectively, along with a methyl group at the 3 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other complex molecules. The presence of halogens can influence its reactivity, making it a candidate for further functionalization or as an intermediate in chemical synthesis. Additionally, the compound's structure may impart specific electronic and steric effects, which can be relevant in drug design and development. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C10H7BrClN
InChI:InChI=1/C10H7BrClN/c1-6-4-7-5-8(11)2-3-9(7)13-10(6)12/h2-5H,1H3
InChI key:VKGSTGZYRFTWNA-UHFFFAOYSA-N
SMILES:Cc1cc2cc(ccc2nc1Cl)Br
Found 5 products.