CAS 1131-15-3
:Phenylsuccinic anhydride
Description:
Phenylsuccinic anhydride, with the CAS number 1131-15-3, is an organic compound characterized by its anhydride functional group derived from phenylsuccinic acid. It typically appears as a white to light yellow crystalline solid and is known for its relatively high melting point. This compound is soluble in organic solvents such as acetone, chloroform, and ether, but is generally insoluble in water. Phenylsuccinic anhydride is utilized in various applications, including as a reagent in organic synthesis and as an intermediate in the production of polymers and resins. Its reactivity is primarily attributed to the anhydride group, which can undergo hydrolysis to form the corresponding acid or react with nucleophiles. Additionally, it exhibits moderate toxicity, necessitating appropriate safety precautions during handling. Overall, phenylsuccinic anhydride is a valuable compound in chemical research and industrial applications due to its unique structural features and reactivity.
Formula:C10H8O3
InChI:InChI=1/C10H8O3/c11-9-6-8(10(12)13-9)7-4-2-1-3-5-7/h1-5,8H,6H2
InChI key:HDFKMLFDDYWABF-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1CC(=O)OC1=O
Synonyms:- 3-Phenyldihydrofuran-2,5-Dione
- Phenylsuccinic anhydride
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Phenylsuccinic Anhydride
CAS:Formula:C10H8O3Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:176.17Phenylsuccinic anhydride
CAS:Phenylsuccinic anhydrideFormula:C10H8O3Purity:99%Color and Shape:SolidMolecular weight:176.168713-Phenyldihydrofuran-2,5-dione
CAS:Formula:C10H8O3Purity:98%Color and Shape:SolidMolecular weight:176.16873-Phenyldihydrofuran-2,5-dione
CAS:3-Phenyldihydrofuran-2,5-dioneFormula:C10H8O3Purity:99%Molecular weight:176.17Phenylsuccinic anhydride
CAS:Phenylsuccinic anhydride is a reactive, receptor binding, expressed, polycarboxylic acid that has nitrogen atoms. It can be used as an anticancer agent and has shown anticancer activity against α7 nicotinic acetylcholine receptors in the central nervous system. Phenylsuccinic anhydride is also used for the preparation of fluorinated anhydrides for use in nonaqueous solvents.
Formula:C10H8O3Purity:Min. 95%Molecular weight:176.17 g/mol





