CymitQuimica logo

CAS 1131-15-3

:

Phenylsuccinic anhydride

Description:
Phenylsuccinic anhydride, with the CAS number 1131-15-3, is an organic compound characterized by its anhydride functional group derived from phenylsuccinic acid. It typically appears as a white to light yellow crystalline solid and is known for its relatively high melting point. This compound is soluble in organic solvents such as acetone, chloroform, and ether, but is generally insoluble in water. Phenylsuccinic anhydride is utilized in various applications, including as a reagent in organic synthesis and as an intermediate in the production of polymers and resins. Its reactivity is primarily attributed to the anhydride group, which can undergo hydrolysis to form the corresponding acid or react with nucleophiles. Additionally, it exhibits moderate toxicity, necessitating appropriate safety precautions during handling. Overall, phenylsuccinic anhydride is a valuable compound in chemical research and industrial applications due to its unique structural features and reactivity.
Formula:C10H8O3
InChI:InChI=1/C10H8O3/c11-9-6-8(10(12)13-9)7-4-2-1-3-5-7/h1-5,8H,6H2
InChI key:HDFKMLFDDYWABF-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1CC(=O)OC1=O
Synonyms:
  • 3-Phenyldihydrofuran-2,5-Dione
  • Phenylsuccinic anhydride
Found 6 products.