CymitQuimica logo

CAS 1131007-45-8

:

6-(Trifluoromethoxy)-2-pyridinamine

Description:
6-(Trifluoromethoxy)-2-pyridinamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethoxy group (-O-CF3) at the 6-position of the pyridine ring significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the electronegative fluorine atoms, which can enhance intermolecular interactions. The trifluoromethoxy group is known for its electron-withdrawing properties, which can affect the compound's acidity and basicity. Additionally, 6-(Trifluoromethoxy)-2-pyridinamine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Safety data should be consulted for handling and storage, as compounds containing fluorine can pose specific health and environmental risks. Overall, this compound exemplifies the importance of functional groups in determining the behavior and applications of organic molecules.
Formula:C6H5F3N2O
InChI:InChI=1S/C6H5F3N2O/c7-6(8,9)12-5-3-1-2-4(10)11-5/h1-3H,(H2,10,11)
InChI key:InChIKey=ANASNIOXOHMDMN-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1N=C(N)C=CC1
Synonyms:
  • 2-Pyridinamine, 6-(trifluoromethoxy)-
  • 6-(Trifluoromethoxy)-2-pyridinamine
Found 3 products.