CymitQuimica logo

CAS 113119-46-3

:

Bis(2,4,6-trimethylpyridine)iodine(I) hexafluorophosphate

Description:
Bis(2,4,6-trimethylpyridine)iodine(I) hexafluorophosphate, with the CAS number 113119-46-3, is a chemical compound that serves as a reagent in organic synthesis, particularly in the field of oxidation reactions. This substance features a central iodine atom bonded to two 2,4,6-trimethylpyridine ligands, which are known for their strong electron-donating properties. The hexafluorophosphate anion (PF6-) is a stable and non-coordinating counterion that enhances the solubility of the compound in polar solvents. The compound is typically characterized by its high stability and reactivity, making it useful in various synthetic applications. It is often handled with care due to its potential toxicity and the presence of iodine, which can be hazardous. In terms of physical properties, it is usually a solid at room temperature and may exhibit a range of colors depending on its purity and form. Overall, this compound is valuable in the synthesis of complex organic molecules and in the development of new chemical methodologies.
Formula:C16H22IN2
InChI:InChI=1/C16H22IN2/c1-11-7-13(3)18(14(4)8-11)17-19-15(5)9-12(2)10-16(19)6/h7-10H,1-6H3/q+1
InChI key:ZQFVHVVVDAIMQV-UHFFFAOYSA-N
SMILES:Cc1cc(C)n(=IN2C(C)C=C(C)C=C2C)c(C)c1
Found 4 products.