CymitQuimica logo

CAS 113124-09-7

:

3-Pyridinecarbonitrile,5,6-dimethyl-(9CI)

Description:
3-Pyridinecarbonitrile, 5,6-dimethyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the cyano group (-C≡N) at the 3-position of the pyridine ring contributes to its reactivity and potential applications in various chemical syntheses. The dimethyl substituents at the 5 and 6 positions enhance the compound's steric properties and influence its electronic characteristics. This compound is typically a colorless to pale yellow solid and is soluble in polar organic solvents. It may be used in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its functional groups that can participate in further chemical reactions. As with many nitrogen-containing heterocycles, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with cyano groups can be toxic and require appropriate precautions during use.
Formula:C8H8N2
InChI:InChI=1S/C8H8N2/c1-6-3-8(4-9)5-10-7(6)2/h3,5H,1-2H3
InChI key:WKGURDJVSXADDE-UHFFFAOYSA-N
SMILES:CC1=CC(=CN=C1C)C#N
Found 5 products.