CymitQuimica logo

CAS 1131587-79-5

:

Methyl 5-bromo-2-(4-morpholinyl)benzoate

Description:
Methyl 5-bromo-2-(4-morpholinyl)benzoate is an organic compound characterized by its structure, which includes a benzoate moiety substituted with a bromine atom and a morpholine group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The morpholine group, a six-membered ring containing both oxygen and nitrogen, contributes to the compound's potential biological activity and solubility properties. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the methyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, further expanding its utility in chemical reactions. Overall, Methyl 5-bromo-2-(4-morpholinyl)benzoate is a versatile compound with potential applications in various fields of chemistry.
Formula:C12H14BrNO3
InChI:InChI=1S/C12H14BrNO3/c1-16-12(15)10-8-9(13)2-3-11(10)14-4-6-17-7-5-14/h2-3,8H,4-7H2,1H3
InChI key:InChIKey=DBJNZTNIRZHOJQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=CC(Br)=C1)N2CCOCC2
Synonyms:
  • Methyl 5-bromo-2-(4-morpholinyl)benzoate
  • Benzoic acid, 5-bromo-2-(4-morpholinyl)-, methyl ester
Found 3 products.