CymitQuimica logo

CAS 1131587-94-4

:

methyl 5-bromo-4-methoxy-2-methylbenzoate

Description:
Methyl 5-bromo-4-methoxy-2-methylbenzoate is an organic compound characterized by its aromatic structure, which includes a methoxy group and a bromine substituent on the benzene ring. The presence of the methyl ester functional group contributes to its reactivity and solubility properties. This compound typically exhibits moderate polarity due to the methoxy and ester groups, making it soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water. The bromine atom introduces a halogen, which can enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, the methoxy group can influence the electronic properties of the aromatic ring, potentially affecting its reactivity in electrophilic aromatic substitution reactions. Methyl 5-bromo-4-methoxy-2-methylbenzoate may be utilized in various synthetic applications, including the development of pharmaceuticals or agrochemicals, owing to its functional groups that allow for further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H11BrO3
InChI:InChI=1S/C10H11BrO3/c1-6-4-9(13-2)8(11)5-7(6)10(12)14-3/h4-5H,1-3H3
InChI key:HDWIBWADMXRCQE-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1C(=O)OC)Br)OC
Found 3 products.