CymitQuimica logo

CAS 1131588-02-7

:

4-Cyclopropyl-3-iodobenzoic acid

Description:
4-Cyclopropyl-3-iodobenzoic acid is an organic compound characterized by its unique structure, which includes a cyclopropyl group and an iodine atom attached to a benzoic acid framework. This compound features a carboxylic acid functional group (-COOH), which contributes to its acidic properties and solubility in polar solvents. The presence of the cyclopropyl group introduces strain and can influence the compound's reactivity and stability. The iodine substituent enhances the compound's electrophilicity, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's aromatic nature allows for resonance stabilization, which can affect its physical properties, such as melting and boiling points. 4-Cyclopropyl-3-iodobenzoic acid may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity can be further explored in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C10H9IO2
InChI:InChI=1S/C10H9IO2/c11-9-5-7(10(12)13)3-4-8(9)6-1-2-6/h3-6H,1-2H2,(H,12,13)
InChI key:InChIKey=QDVBTTDZXICGEK-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(O)=O)=C1)C2CC2
Synonyms:
  • 4-Cyclopropyl-3-iodobenzoic acid
  • Benzoic acid, 4-cyclopropyl-3-iodo-
Found 3 products.