CymitQuimica logo

CAS 1131735-94-8

:

(4-(Diisopropylcarbamoyl)-2-ethoxypyridin-3-yl)boronicacid

Description:
(4-(Diisopropylcarbamoyl)-2-ethoxypyridin-3-yl)boronic acid is a boronic acid derivative characterized by its unique functional groups, which include a pyridine ring, a diisopropylcarbamoyl moiety, and an ethoxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridine ring contributes to its aromatic character and potential for coordination with metal ions. Additionally, the diisopropylcarbamoyl group enhances its solubility and stability in organic solvents. The compound may also exhibit biological activity, which can be explored in drug development contexts. Its specific reactivity and interactions depend on the surrounding conditions, such as pH and the presence of other functional groups. Overall, this compound represents a versatile building block in the synthesis of more complex molecules in pharmaceutical and materials chemistry.
Formula:C14H23BN2O4
InChI:InChI=1S/C14H23BN2O4/c1-6-21-13-12(15(19)20)11(7-8-16-13)14(18)17(9(2)3)10(4)5/h7-10,19-20H,6H2,1-5H3
InChI key:ANZPBKCEGYLFFT-UHFFFAOYSA-N
SMILES:B(C1=C(C=CN=C1OCC)C(=O)N(C(C)C)C(C)C)(O)O
Found 4 products.