CymitQuimica logo

CAS 1131737-04-6

:

(αR)-α-(Trifluoromethyl)cyclopropanemethanamine

Description:
(αR)-α-(Trifluoromethyl)cyclopropanemethanamine is a chemical compound characterized by its unique cyclopropane structure, which includes a trifluoromethyl group attached to the alpha position of the cyclopropane ring. This trifluoromethyl group significantly influences the compound's electronic properties, making it more lipophilic and potentially enhancing its biological activity. The presence of the amine functional group suggests that it may engage in hydrogen bonding, which can affect its solubility and reactivity. The stereochemistry indicated by the (αR) designation implies that the compound has a specific spatial arrangement, which can be crucial for its interaction with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Additionally, the trifluoromethyl group is often associated with increased metabolic stability and altered pharmacokinetics, making such compounds valuable in the design of therapeutics. Overall, (αR)-α-(Trifluoromethyl)cyclopropanemethanamine represents a class of compounds that could have significant implications in various chemical and biological applications.
Formula:C5H8F3N
InChI:InChI=1S/C5H8F3N/c6-5(7,8)4(9)3-1-2-3/h3-4H,1-2,9H2/t4-/m1/s1
InChI key:InChIKey=DMWCDCMZMZULIE-SCSAIBSYSA-N
SMILES:[C@@H](C(F)(F)F)(N)C1CC1
Synonyms:
  • (1R)-1-Cyclopropyl-2,2,2-trifluoroethanamine
  • (R)-1-Cyclopropyl-2,2,2-trifluoroethanamine
  • (αR)-α-(Trifluoromethyl)cyclopropanemethanamine
  • (1R)-1-Cyclopropyl-2,2,2-trifluoroethan-1-amine
  • Cyclopropanemethanamine, α-(trifluoromethyl)-, (αR)-
Found 1 products.