CymitQuimica logo

CAS 1132-40-7

:

2-HYDROXYIMINO-N-P-TOLYL-ACETAMIDE

Description:
2-Hydroxyimino-N-p-tolyl-acetamide, with the CAS number 1132-40-7, is an organic compound characterized by the presence of a hydroxylamine functional group and an acetamide moiety. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. It features a p-tolyl group, which contributes to its hydrophobic characteristics, while the hydroxylamine group imparts reactivity, particularly in nucleophilic addition reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Its structure allows for potential interactions with various biological targets, and it may participate in reactions such as oxidation or condensation. The stability of 2-hydroxyimino compounds can vary, and they may be sensitive to changes in pH or temperature. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Overall, 2-hydroxyimino-N-p-tolyl-acetamide is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C9H10N2O2
InChI:InChI=1/C9H10N2O2/c1-7-2-4-8(5-3-7)11-9(12)6-10-13/h2-6,13H,1H3,(H,11,12)/b10-6+
InChI key:AEWRKRLVPROQRN-UXBLZVDNSA-N
SMILES:CC1=CC=C(C=C1)NC(=O)/C=N/O
Synonyms:
  • N1-(4-methylphenyl)-2-hydroxyiminoacetamide
  • (2Z)-2-(hydroxyimino)-N-(4-methylphenyl)ethanamide
  • (2E)-2-(hydroxyimino)-N-(4-methylphenyl)ethanamide
Found 1 products.