CymitQuimica logo

CAS 1132638-94-8

:

Methyl 7-methyl-1H-benzimidazole-5-carboxylate

Description:
Methyl 7-methyl-1H-benzimidazole-5-carboxylate is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a methyl group at the 7-position and a carboxylate ester functional group, specifically a methyl ester, at the 5-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be influenced by the substituents on the benzimidazole ring. Overall, Methyl 7-methyl-1H-benzimidazole-5-carboxylate is a versatile compound with unique chemical properties that warrant further investigation for its potential applications.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-6-3-7(10(13)14-2)4-8-9(6)12-5-11-8/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=TZGLOAYDZCQGMQ-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC(C(OC)=O)=C1)N=CN2
Synonyms:
  • Methyl 7-methyl-1H-benzimidazole-5-carboxylate
  • Methyl 7-methyl-3H-benzimidazole-5-carboxylate
  • 1H-Benzimidazole-5-carboxylic acid, 7-methyl-, methyl ester
  • Methyl 7-Methyl-1H-benzo[d]imidazole-5-carboxylate
Found 2 products.