CymitQuimica logo

CAS 113274-57-0

:

N-acetyl-hirudin fragment 55-65

Description:
N-acetyl-hirudin fragment 55-65 is a synthetic peptide derived from hirudin, a potent anticoagulant protein originally isolated from leeches. This specific fragment consists of amino acids 55 to 65 of the hirudin sequence and is known for its ability to inhibit thrombin, an enzyme critical in the blood coagulation process. The N-acetyl modification enhances its stability and solubility, making it more effective in therapeutic applications. Characteristically, this peptide exhibits high specificity for thrombin, which allows it to prevent clot formation without significantly affecting other coagulation pathways. Its molecular structure includes a sequence of amino acids that contribute to its binding affinity and biological activity. N-acetyl-hirudin fragment 55-65 is utilized in research and potential clinical settings, particularly in the development of anticoagulant therapies. As with many peptides, its stability can be influenced by environmental factors such as pH and temperature, and it is typically stored under controlled conditions to maintain its integrity.
Formula:C66H92N12O25
InChI:InChI=1S/C66H92N12O25/c1-6-34(4)55(77-59(95)42(22-27-53(88)89)70-56(92)39(19-24-50(82)83)71-61(97)45(30-36-11-8-7-9-12-36)76-63(99)47(32-54(90)91)68-35(5)79)65(101)78-28-10-13-48(78)64(100)72-41(21-26-52(86)87)57(93)69-40(20-25-51(84)85)58(94)75-46(31-37-14-16-38(80)17-15-37)62(98)74-44(29-33(2)3)60(96)73-43(66(102)103)18-23-49(67)81/h7-9,11-12,14-17,33-34,39-48,55,80H,6,10,13,18-32H2,1-5H3,(H2,67,81)(H,68,79)(H,69,93)(H,70,92)(H,71,97)(H,72,100)(H,73,96)(H,74,98)(H,75,94)(H,76,99)(H,77,95)(H,82,83)(H,84,85)(H,86,87)(H,88,89)(H,90,91)(H,102,103)/t34-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48-,55-/m0/s1
InChI key:IEAUQSWIFZNYCL-XALAVQSDSA-N
SMILES:CC[C@H](C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)N)C(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC3=CC=CC=C3)NC(=O)[C@H](CC(=O)O)NC(=O)C
Synonyms:
  • Acetyl-Hirudin (55-65) (desulfated)
  • Ac-Asp-Phe-Glu-Glu-Ile-Pro-Glu-Glu-Tyr-Leu-Gln-OH
Found 3 products.