CAS 113293-71-3
:(6-Amino-3-Pyridinyl)Methanol
Description:
(6-Amino-3-Pyridinyl)Methanol, with the CAS number 113293-71-3, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to the pyridine ring, contributing to its reactivity and potential biological activity. The presence of the amino group allows for hydrogen bonding and can enhance solubility in polar solvents, while the hydroxymethyl group can participate in various chemical reactions, including oxidation and substitution. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmaceutical applications, given the importance of pyridine derivatives in medicinal chemistry. Its molecular structure suggests that it could interact with biological systems, making it of interest for further research in drug development or as a biochemical probe. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c7-6-2-1-5(4-9)3-8-6/h1-3,9H,4H2,(H2,7,8)
SMILES:c1cc(=N)[nH]cc1CO
Synonyms:- 6-Amino-3-hydroxymethylpyridine
- (6-Amino-pyridin-3-YL)-Methanol
- 2-Amino-5-(hydroxymethyl)pyridine
- 2-Amino-5-pyridinemethanol
- 3-Pyridinemethanol, 6-amino-
- 2-Amino-5-Pyridinemethanol(2-Amino-5-hydroxymethylpyridine)
- (6-AMINO-3-PYRIDINYL)METHANOL
- 3-Pyridinemethanol,6-amino-(9CI)
- (6-Aminopyridin-3-yl)methanol, 6-Aminonicotinyl alcohol
- 2-AMinopyridine-5-Methanol
- 2-Amino-5-hydroxymethylpy...
- 2-Amino-5-(hydroxymethyl)pyridine 97%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-5-pyridinemethanol
CAS:Formula:C6H8N2OPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:124.142-Amino-5-(hydroxymethyl)pyridine
CAS:2-Amino-5-(hydroxymethyl)pyridineFormula:C6H8N2OPurity:97%Color and Shape:Solid-PowderMolecular weight:124.14052(6-Amino-3-pyridinyl)methanol
CAS:Formula:C6H8N2OPurity:96%Color and Shape:SolidMolecular weight:124.1405(6-Amino-3-pyridinyl)methanol
CAS:Formula:C6H8N2OPurity:96%Color and Shape:Solid, Yellow powderMolecular weight:124.1432-Amino-5-pyridinemethanol
CAS:2-Amino-5-pyridinemethanol is a human metabolite of zolpidem. It is synthesized by the esterification of 2-amino-4-(1,2,3,6-tetrahydropyridin-4-yl)benzaldehyde with methanol. This product can be used to analyze the concentration of zolpidem in human blood samples. The chemical structure has been confirmed by IR and MS spectra and it's hydrolyzed to form 2-(2'-hydroxyphenyl)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]acetamide after analysis.Formula:C6H8N2OPurity:Min. 95%Molecular weight:124.14 g/mol




