CymitQuimica logo

CAS 1133-42-2

:

1-methyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione

Description:
1-Methyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione, commonly referred to as a benzodiazepine derivative, is characterized by its bicyclic structure that includes a benzene ring fused to a diazepine ring. This compound features a methyl group at the nitrogen atom in the 1-position and two carbonyl groups at the 2 and 5 positions, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in organic solvents while being less soluble in water. The presence of the carbonyl groups suggests potential reactivity in nucleophilic addition reactions. As a member of the benzodiazepine family, it may exhibit biological activity, particularly in the central nervous system, although specific pharmacological effects can vary. Its CAS number, 1133-42-2, allows for precise identification in chemical databases. Safety and handling precautions should be observed, as with many benzodiazepines, due to potential effects on human health and the environment.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-12-8-5-3-2-4-7(8)10(14)11-6-9(12)13/h2-5H,6H2,1H3,(H,11,14)
InChI key:MUESRUHFMTYDIT-UHFFFAOYSA-N
SMILES:CN1c2ccccc2C(=NCC1=O)O
Synonyms:
  • 1H-1,4-benzodiazepine-2,5-dione, 3,4-dihydro-1-methyl-
Found 3 products.