CymitQuimica logo

CAS 1133115-72-6

:

Quinoline, 6-bromo-5,8-difluoro-

Description:
Quinoline, 6-bromo-5,8-difluoro- is a heterocyclic aromatic compound characterized by a fused ring system containing a benzene ring and a pyridine ring. The presence of bromine and fluorine substituents at specific positions on the quinoline structure significantly influences its chemical properties and reactivity. Typically, compounds like this exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. The bromine atom can serve as a site for further chemical reactions, such as nucleophilic substitutions, while the fluorine atoms can enhance the compound's stability and alter its electronic properties. Quinoline derivatives are often studied for their biological activities, including potential applications in pharmaceuticals and agrochemicals. The specific arrangement of the substituents can also impact the compound's spectral properties, making it useful in various analytical techniques. Overall, 6-bromo-5,8-difluoroquinoline represents a versatile structure with significant implications in both synthetic and medicinal chemistry.
Formula:C9H4BrF2N
InChI:InChI=1S/C9H4BrF2N/c10-6-4-7(11)9-5(8(6)12)2-1-3-13-9/h1-4H
InChI key:InChIKey=GVFUBMHGLPCFNH-UHFFFAOYSA-N
SMILES:FC=1C2=C(C(F)=CC1Br)N=CC=C2
Synonyms:
  • 6-Bromo-5,8-difluoroquinoline
  • Quinoline, 6-bromo-5,8-difluoro-
Found 4 products.