CymitQuimica logo

CAS 113366-43-1

:

4-Thiazolecarboxylic acid, 5-methyl-2-phenyl-

Description:
4-Thiazolecarboxylic acid, 5-methyl-2-phenyl- is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a phenyl group, which can influence its reactivity and solubility. The presence of the methyl group at the 5-position of the thiazole ring adds to its molecular complexity and can affect its biological activity. Generally, compounds of this type may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The specific arrangement of substituents on the thiazole ring can lead to diverse chemical behaviors, including potential interactions with biological targets. Additionally, the compound's solubility and stability can be influenced by its functional groups and overall molecular structure. As with many thiazole derivatives, this compound may be explored for applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis.
Formula:C11H9NO2S
InChI:InChI=1S/C11H9NO2S/c1-7-9(11(13)14)12-10(15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14)
InChI key:SDQFOJCLVJKFPG-UHFFFAOYSA-N
SMILES:CC1=C(N=C(S1)C2=CC=CC=C2)C(=O)O
Found 2 products.