CymitQuimica logo

CAS 113421-97-9

:

4-Chloro-3-(trifluoromethoxy)nitrobenzene

Description:
4-Chloro-3-(trifluoromethoxy)nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group and a chloro substituent on a benzene ring. The presence of the trifluoromethoxy group significantly influences its chemical properties, enhancing its electronegativity and making it a strong candidate for various chemical reactions. This compound is typically a solid at room temperature and is known for its stability under standard conditions. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, and materials science, particularly due to the electron-withdrawing effects of the trifluoromethoxy and nitro groups, which can affect reactivity and solubility. Additionally, the compound may exhibit specific interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 4-Chloro-3-(trifluoromethoxy)nitrobenzene is a versatile compound with significant implications in various fields of chemistry.
Formula:C7H3ClF3NO3
InChI:InChI=1S/C7H3ClF3NO3/c8-5-2-1-4(12(13)14)3-6(5)15-7(9,10)11/h1-3H
InChI key:WVRGIODBGXCYRU-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1[N+](=O)[O-])OC(F)(F)F)Cl
Found 2 products.