
CAS 113423-47-5
:3,3-DIBROMO-4-NITRO-OXINDOLE
Description:
3,3-Dibromo-4-nitro-oxindole is a chemical compound characterized by its oxindole structure, which is a bicyclic compound featuring an indole and a carbonyl group. The presence of two bromine atoms at the 3-position and a nitro group at the 4-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The bromine substituents can enhance its lipophilicity, potentially affecting its bioavailability and pharmacokinetics. Additionally, the nitro group can serve as a site for further chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 3,3-dibromo-4-nitro-oxindole is a compound of interest in both research and industrial applications.
Formula:C8H4Br2N2O3
InChI:InChI=1S/C8H4Br2N2O3/c9-8(10)6-4(11-7(8)13)2-1-3-5(6)12(14)15/h1-3H,(H,11,13)
InChI key:QEJAAGICYWWRKH-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)[N+](=O)[O-])C(C(=O)N2)(Br)Br
Synonyms:- 2H-Indol-2-one, 3,3-dibromo-1,3-dihydro-5-nitro-
- 3,3-Dibromo-4-nitroindolin-2-one
- 3,3-dibromo-5-nitro-indolin-2-one
- 3,3-DIBROMO-4-NITRO-OXINDOLE
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
