CymitQuimica logo

CAS 113493-77-9

:

1-Propanone, 3-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-1-phenyl-

Description:
1-Propanone, 3-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-1-phenyl-, also known by its CAS number 113493-77-9, is an organic compound characterized by its ketone functional group and multiple substituents that contribute to its chemical properties. This compound features a propanone backbone with a hydroxyl group, indicating it has alcohol characteristics, and is further substituted with two methyl groups and a phenyl group, which enhance its hydrophobic nature and influence its reactivity. The presence of the 4-methylphenyl group adds to its complexity, potentially affecting its steric and electronic properties. This compound may exhibit interesting solubility characteristics, likely being more soluble in organic solvents than in water due to its hydrophobic components. Its structural features suggest potential applications in organic synthesis or as an intermediate in the production of more complex molecules. However, specific reactivity, stability, and safety data would require further investigation through empirical studies or literature review.
Formula:C18H20O2
InChI:InChI=1S/C18H20O2/c1-13-9-11-15(12-10-13)17(20)18(2,3)16(19)14-7-5-4-6-8-14/h4-12,17,20H,1-3H3
InChI key:LRCZYBRKFFOCFV-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C(C(C)(C)C(=O)C2=CC=CC=C2)O
Found 1 products.