CymitQuimica logo

CAS 113509-54-9

:

Adenosine, N-methyl-, 1-oxide

Description:
Adenosine, N-methyl-, 1-oxide, with the CAS number 113509-54-9, is a modified nucleoside derivative of adenosine. This compound features a methyl group attached to the nitrogen atom of the adenine base, along with an oxide functional group. It is characterized by its role in various biochemical processes, particularly in cellular signaling and metabolism. The presence of the methyl and oxide groups can influence its biological activity, potentially affecting its interaction with receptors and enzymes. This compound is soluble in polar solvents, which is typical for nucleosides, and may exhibit varying degrees of stability depending on environmental conditions such as pH and temperature. Its structural modifications can also impact its pharmacological properties, making it of interest in research related to neurobiology and pharmacology. Overall, adenosine derivatives like N-methyl-1-oxide are valuable in studying cellular functions and developing therapeutic agents.
Formula:C11H15N5O5
InChI:InChI=1S/C11H15N5O5/c1-12-9-6-10(14-4-16(9)20)15(3-13-6)11-8(19)7(18)5(2-17)21-11/h3-5,7-8,11,17-20H,2H2,1H3/t5-,7-,8-,11-/m1/s1
InChI key:WSNFPBJZRWYJBW-IOSLPCCCSA-N
SMILES:CN=C1C2=C(N=CN1O)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O
Found 2 products.