CymitQuimica logo

CAS 113522-19-3

:

4-(2-methoxyphenyl)-4-oxo-butanenitrile

Description:
4-(2-Methoxyphenyl)-4-oxo-butanenitrile, identified by its CAS number 113522-19-3, is an organic compound characterized by its functional groups, including a nitrile and a ketone. The presence of the methoxyphenyl group contributes to its aromatic properties, while the butanenitrile structure indicates a four-carbon chain with a cyano group. This compound typically exhibits moderate polarity due to the presence of both polar (nitrile) and non-polar (aromatic) components, influencing its solubility in various solvents. It may participate in various chemical reactions, such as nucleophilic additions or substitutions, owing to the reactive nature of the nitrile and carbonyl functionalities. Additionally, the compound's structure suggests potential applications in pharmaceuticals or organic synthesis, where its unique characteristics can be leveraged for the development of biologically active molecules. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c1-14-11-7-3-2-5-9(11)10(13)6-4-8-12/h2-3,5,7H,4,6H2,1H3
InChI key:YZDPMHCJJPNPAB-UHFFFAOYSA-N
SMILES:COc1ccccc1C(=O)CCC#N
Found 2 products.