CymitQuimica logo

CAS 1135282-92-6

:

2-Bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine

Description:
2-Bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 2-position and a trifluoromethyl group at the 6-position enhances its reactivity and lipophilicity, making it a valuable intermediate in pharmaceutical synthesis and agrochemical applications. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its structure allows for potential interactions with biological targets, which is of interest in medicinal chemistry. The trifluoromethyl group is known to influence the electronic properties of the molecule, often enhancing its biological activity. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 2-Bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine is notable for its functional groups and structural features that facilitate various chemical reactions and applications.
Formula:C8H4BrF3N2
InChI:InChI=1S/C8H4BrF3N2/c9-6-4-14-3-5(8(10,11)12)1-2-7(14)13-6/h1-4H
InChI key:InChIKey=ZZHFDHQEFBAXGI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CN2C(C=C1)=NC(Br)=C2
Synonyms:
  • 2-Bromo-6-trifluoromethylimidazo[1,2-a]pyridine
  • 2-Bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine
  • Imidazo[1,2-a]pyridine, 2-bromo-6-(trifluoromethyl)-
Found 3 products.