CymitQuimica logo

CAS 1135282-94-8

:

6-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid hydrazide

Description:
6-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include a benzo[b]thiophene core, a trifluoromethyl group, and a hydrazide functional group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The hydrazide moiety can participate in various chemical reactions, including hydrazone formation and potential interactions with biological targets. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, which are common in derivatives of thiophene and hydrazide. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and development. Additionally, the compound's molecular structure suggests potential for further derivatization, allowing for the exploration of its reactivity and utility in synthetic chemistry. Overall, this compound represents a valuable scaffold for further investigation in medicinal chemistry and material science.
Formula:C10H7F3N2OS
InChI:InChI=1S/C10H7F3N2OS/c11-10(12,13)6-2-1-5-3-8(9(16)15-14)17-7(5)4-6/h1-4H,14H2,(H,15,16)
InChI key:InChIKey=UACNNQTXWMOXIK-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1SC=2C(C1)=CC=C(C(F)(F)F)C2
Synonyms:
  • 6-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid hydrazide
  • Benzo[b]thiophene-2-carboxylic acid, 6-(trifluoromethyl)-, hydrazide
Found 1 products.