CymitQuimica logo

CAS 1135283-10-1

:

1-Ethynyl-2-methoxy-4-nitrobenzene

Description:
1-Ethynyl-2-methoxy-4-nitrobenzene is an organic compound characterized by its unique functional groups and structural features. It contains an ethynyl group, which is a carbon-carbon triple bond, contributing to its reactivity and potential applications in organic synthesis. The presence of a methoxy group (-OCH3) indicates that it has ether characteristics, which can influence its solubility and polarity. Additionally, the nitro group (-NO2) is a strong electron-withdrawing group, which can enhance the compound's electrophilic properties. This compound is likely to be a yellow to orange solid, given the presence of the nitro group, which often imparts color to organic compounds. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, due to the presence of the nitro group, it may also exhibit toxicity and require careful handling. Overall, 1-Ethynyl-2-methoxy-4-nitrobenzene is a versatile compound with significant implications in various chemical fields.
Formula:C9H7NO3
InChI:InChI=1S/C9H7NO3/c1-3-7-4-5-8(10(11)12)6-9(7)13-2/h1,4-6H,2H3
InChI key:InChIKey=IYZORHPOENKIKL-UHFFFAOYSA-N
SMILES:O(C)C1=C(C#C)C=CC(N(=O)=O)=C1
Synonyms:
  • 1-Ethynyl-2-methoxy-4-nitrobenzene
  • Benzene, 1-ethynyl-2-methoxy-4-nitro-
Found 5 products.