CymitQuimica logo

CAS 1135283-33-8

:

2,3-Dichloro-5-(trifluoromethyl)-4-pyridinecarboxylic acid

Description:
2,3-Dichloro-5-(trifluoromethyl)-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 3 positions with chlorine atoms and at the 5 position with a trifluoromethyl group. The presence of the carboxylic acid functional group at the 4 position contributes to its acidic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its trifluoromethyl group enhances lipophilicity and can influence biological activity, making it of interest in pharmaceutical and agrochemical research. The dichloro substitutions can also affect the compound's reactivity and stability. Overall, 2,3-Dichloro-5-(trifluoromethyl)-4-pyridinecarboxylic acid is notable for its unique structural features, which may impart specific chemical properties and potential applications in various fields, including medicinal chemistry and material science.
Formula:C7H2Cl2F3NO2
InChI:InChI=1S/C7H2Cl2F3NO2/c8-4-3(6(14)15)2(7(10,11)12)1-13-5(4)9/h1H,(H,14,15)
InChI key:InChIKey=WCIZQAPCTNIIGD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C(F)(F)F)=CN=C(Cl)C1Cl
Synonyms:
  • 4-Pyridinecarboxylic acid, 2,3-dichloro-5-(trifluoromethyl)-
  • 2,3-Dichloro-5-(trifluoromethyl)-4-pyridinecarboxylic acid
Found 3 products.