CymitQuimica logo

CAS 113558-03-5

:

1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid

Description:
1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid, with the CAS number 113558-03-5, is a naturally occurring triterpenoid compound derived from various plant sources. This substance is characterized by its complex polycyclic structure, which includes multiple hydroxyl (-OH) functional groups that contribute to its solubility and reactivity. The presence of these hydroxyl groups enhances its potential biological activity, including antioxidant and anti-inflammatory properties. Triterpenoids like this compound are often studied for their pharmacological effects, including potential applications in traditional medicine and modern therapeutics. The specific arrangement of hydroxyl groups and the overall steric configuration of the molecule play crucial roles in its interaction with biological systems. Additionally, this compound may exhibit varying degrees of lipophilicity and hydrophilicity, influencing its absorption and distribution in biological organisms. Overall, 1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid represents a significant area of interest in natural product chemistry and pharmacognosy.
Formula:C30H48O6
InChI:InChI=1S/C30H48O6/c1-16-10-13-30(24(34)35)15-14-26(4)17(21(30)29(16,7)36)8-9-19-27(26,5)12-11-18-25(2,3)22(32)20(31)23(33)28(18,19)6/h8,16,18-23,31-33,36H,9-15H2,1-7H3,(H,34,35)/t16-,18+,19+,20+,21-,22+,23-,26-,27-,28+,29-,30+/m1/s1
InChI key:VULLSLYDWNGNKZ-VVEUJWIUSA-N
SMILES:C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4([C@@H]([C@H]([C@@H](C5(C)C)O)O)O)C)C)[C@@H]2[C@]1(C)O)C)C(=O)O
Found 5 products.