CymitQuimica logo

CAS 113568-93-7

:

(1E)-1-{[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]imino}-8,9-dihydroxy-4-methoxy-2,3,6a,8,9,9a-hexahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromen-11(1H)-one

Description:
The chemical substance with the name "(1E)-1-{[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]imino}-8,9-dihydroxy-4-methoxy-2,3,6a,8,9,9a-hexahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromen-11(1H)-one" and CAS number "113568-93-7" is a complex organic compound characterized by its intricate molecular structure, which includes multiple hydroxyl groups, a methoxy group, and a fused ring system. This compound is likely to exhibit significant biological activity due to the presence of functional groups that can participate in hydrogen bonding and other interactions. Its structure suggests potential applications in medicinal chemistry, possibly as a lead compound for drug development. The presence of multiple stereocenters indicates that it may exist in different stereoisomeric forms, which can influence its pharmacological properties. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular architecture, making it a subject of interest for further research in both synthetic and applied chemistry.
Formula:C21H23NO10
InChI:InChI=1/C21H23NO10/c1-29-10-4-11-14(15-16(26)19(28)32-20(15)30-11)17-13(10)8-2-3-9(12(8)18(27)31-17)22-21(5-23,6-24)7-25/h4,15-16,19-20,23-26,28H,2-3,5-7H2,1H3/b22-9+
InChI key:FDHBXCJFVVNQKW-UHFFFAOYSA-N
SMILES:COC1=C2C3=C(C(=NC(CO)(CO)CO)CC3)C(=O)OC2=C4C5C(C(OC5OC4=C1)O)O
Found 1 products.