CymitQuimica logo

CAS 1135916-70-9

:

TERT-BUTYL 3-(1-AMINO-2-METHOXY-2-Oxoethyl)pyrrolidine-1-Carboxylate

Description:
TERT-BUTYL 3-(1-AMINO-2-METHOXY-2-OXOETHYL)pyrrolidine-1-Carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring, a tert-butyl group, and an amino acid derivative. This compound features a carboxylate functional group, which contributes to its potential as a building block in organic synthesis and medicinal chemistry. The presence of the methoxy and oxoethyl groups enhances its reactivity and solubility in various solvents, making it suitable for diverse applications. The tert-butyl group provides steric hindrance, which can influence the compound's biological activity and interaction with other molecules. Additionally, the amino group may participate in hydrogen bonding, further affecting its chemical behavior. Overall, this compound's unique structural features suggest potential utility in drug development and as a precursor in the synthesis of more complex organic molecules. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods for practical applications.
Formula:C12H22N2O4
InChI:InChI=1S/C12H22N2O4/c1-12(2,3)18-11(16)14-6-5-8(7-14)9(13)10(15)17-4/h8-9H,5-7,13H2,1-4H3
InChI key:IOYJGIAHVAQCPO-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(C1)C(C(=O)OC)N
Found 4 products.