CAS 1136-45-4
:5-Methyl-3-phenylisoxazole-4-carboxylic acid
Description:
5-Methyl-3-phenylisoxazole-4-carboxylic acid is a heterocyclic organic compound characterized by its isoxazole ring structure, which consists of a five-membered ring containing both nitrogen and oxygen atoms. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential applications. The carboxylic acid functional group (-COOH) enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and syntheses. The presence of the phenyl group can also influence its reactivity and interactions with other molecules, potentially allowing for applications in pharmaceuticals or agrochemicals. Additionally, the compound may exhibit biological activity, which is often a focus in medicinal chemistry. Its molecular structure allows for various derivatizations, making it a versatile building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c1-7-9(11(13)14)10(12-15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14)
InChI key:InChIKey=PENHKTNQUJMHIR-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=NOC1C)C2=CC=CC=C2
Synonyms:- 3-Phenyl-5-methylisoxazole-4-carboxylic acid
- 4-Carboxy-5-methyl-3-phenylisoxazole
- 4-Isoxazolecarboxylic acid, 5-methyl-3-phenyl-
- 5-Methyl-3-Phenyl-1,2-Oxazole-4-Carboxylic Acid
- 5-Methyl-3-phenyl-4-isoxazolecarboxylic acid
- NSC 76870
- PMI-acid
- 5-Methyl-3-phenylisoxazole-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
5-Methyl-3-phenylisoxazole-4-carboxylic acid, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H9NO3Purity:99%Color and Shape:Crystals or powder or crystalline powder, White to cream to pale brownMolecular weight:203.20Oxacillin Related Compound C (5-Methyl-3-phenylisoxazole-4-carboxylic acid)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C11H9NO3Color and Shape:Off-White PowderMolecular weight:203.058244-Isoxazolecarboxylic acid, 5-methyl-3-phenyl-
CAS:Formula:C11H9NO3Purity:98%Color and Shape:SolidMolecular weight:203.1941Oxacillin EP Impurity C (Oxacillin USP Related Compound C)
CAS:Formula:C11H9NO3Molecular weight:203.205-Methyl-3-phenylisoxazole-4-carboxylic Acid
CAS:Controlled ProductFormula:C11H9NO3Color and Shape:NeatMolecular weight:203.195-Methyl-3-phenylisoxazole-4-carboxylic acid
CAS:5-Methyl-3-phenylisoxazole-4-carboxylic acidFormula:C11H9NO3Purity:98%Color and Shape: off-white solidMolecular weight:203.19g/mol5-Methyl-3-phenyl-4-isoxazolecarboxylic Acid
CAS:Controlled ProductFormula:C11H9NO3Color and Shape:NeatMolecular weight:203.195-Methyl-3-phenyl-isoxazole-4-carboxylic acid
CAS:Formula:C11H9NO3Purity:98%Color and Shape:PowderMolecular weight:203.1975-Methyl-3-phenyl-4-isoxazolecarboxylic Acid-d5
CAS:Controlled ProductFormula:C11D5H4NO3Color and Shape:NeatMolecular weight:208.225









