CymitQuimica logo

CAS 1136-45-4

:

5-Methyl-3-phenylisoxazole-4-carboxylic acid

Description:
5-Methyl-3-phenylisoxazole-4-carboxylic acid is a heterocyclic organic compound characterized by its isoxazole ring structure, which consists of a five-membered ring containing both nitrogen and oxygen atoms. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential applications. The carboxylic acid functional group (-COOH) enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and syntheses. The presence of the phenyl group can also influence its reactivity and interactions with other molecules, potentially allowing for applications in pharmaceuticals or agrochemicals. Additionally, the compound may exhibit biological activity, which is often a focus in medicinal chemistry. Its molecular structure allows for various derivatizations, making it a versatile building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c1-7-9(11(13)14)10(12-15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14)
InChI key:InChIKey=PENHKTNQUJMHIR-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=NOC1C)C2=CC=CC=C2
Synonyms:
  • 3-Phenyl-5-methylisoxazole-4-carboxylic acid
  • 4-Carboxy-5-methyl-3-phenylisoxazole
  • 4-Isoxazolecarboxylic acid, 5-methyl-3-phenyl-
  • 5-Methyl-3-Phenyl-1,2-Oxazole-4-Carboxylic Acid
  • 5-Methyl-3-phenyl-4-isoxazolecarboxylic acid
  • NSC 76870
  • PMI-acid
  • 5-Methyl-3-phenylisoxazole-4-carboxylic acid
Found 11 products.