CAS 113678-91-4
:1,2-Benzenediol, 3-ethenyl-
Description:
1,2-Benzenediol, 3-ethenyl-, also known as 3-vinylcatechol, is an organic compound characterized by its aromatic structure featuring a benzene ring with two hydroxyl (-OH) groups at the 1 and 2 positions and a vinyl group (-CH=CH2) at the 3 position. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents and exhibits moderate solubility in water due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The compound is known for its potential applications in the synthesis of polymers and as an intermediate in organic synthesis. Additionally, it may exhibit antioxidant properties due to the presence of the catechol moiety. However, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Its reactivity is influenced by the functional groups present, making it a versatile compound in various chemical reactions.
Formula:C8H8O2
InChI:InChI=1S/C8H8O2/c1-2-6-4-3-5-7(9)8(6)10/h2-5,9-10H,1H2
InChI key:PAPAWUGOOGNNAR-UHFFFAOYSA-N
SMILES:C=CC1=C(C(=CC=C1)O)O
Synonyms:- 2,3-Dihydroxy Styrene
- 1,2-Benzenediol, 3-ethenyl-
- 3-Ethenyl-
- 3-Vinylbenzene-1,2-diol
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
