CymitQuimica logo

CAS 113682-50-1

:

Benzenemethanethiol, 4-chloro-a-methyl-

Description:
Benzenemethanethiol, 4-chloro-α-methyl- (CAS 113682-50-1) is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a thiol group (-SH) and a chloro group (-Cl) at the para position relative to the thiol. The presence of the α-methyl group introduces additional steric effects, influencing its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid with a distinct odor, characteristic of thiols, which are known for their strong and often unpleasant smells. It is soluble in organic solvents but has limited solubility in water due to the hydrophobic nature of the benzene ring. The compound may exhibit moderate toxicity and should be handled with care, following appropriate safety protocols. Its chemical properties make it useful in various applications, including organic synthesis and as a potential intermediate in the production of other chemical compounds.
Formula:C8H9ClS
InChI:InChI=1S/C8H9ClS/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3
InChI key:PXILIQKXAPCUPZ-UHFFFAOYSA-N
SMILES:CC(C1=CC=C(C=C1)Cl)S
Found 2 products.