CymitQuimica logo

CAS 113731-96-7

:

protein kinase C fragment 19-36

Description:
Protein kinase C fragment 19-36, associated with the CAS number 113731-96-7, is a peptide derived from the protein kinase C (PKC) family, which plays a crucial role in various cellular processes, including signal transduction, cell growth, and differentiation. This specific fragment consists of a sequence of amino acids that may be involved in the regulatory functions of PKC. Characteristically, it exhibits properties typical of peptides, such as solubility in aqueous solutions and potential bioactivity, influencing cellular signaling pathways. The fragment may also interact with other proteins or cellular components, contributing to its functional role in cellular mechanisms. Additionally, like many peptides, it may be sensitive to environmental conditions such as pH and temperature, which can affect its stability and activity. Research on such fragments often focuses on their implications in health and disease, particularly in cancer and other disorders where PKC signaling is disrupted. Overall, this fragment serves as a valuable tool in biochemical studies and therapeutic developments.
Formula:C93H159N35O24
InChI:InChI=1S/C93H159N35O24/c1-47(2)39-62(122-74(135)50(7)113-70(132)45-111-77(138)55(24-12-15-33-94)116-78(139)58(27-19-37-109-92(103)104)115-75(136)51(8)114-84(145)63(40-52-21-10-9-11-22-52)123-76(137)54(97)23-18-36-108-91(101)102)85(146)118-59(28-20-38-110-93(105)106)79(140)119-60(29-31-67(98)129)82(143)117-56(25-13-16-34-95)80(141)124-65(42-68(99)130)87(148)128-73(49(5)6)89(150)125-64(41-53-44-107-46-112-53)86(147)120-61(30-32-71(133)134)83(144)127-72(48(3)4)88(149)121-57(26-14-17-35-96)81(142)126-66(90(151)152)43-69(100)131/h9-11,21-22,44,46-51,54-66,72-73H,12-20,23-43,45,94-97H2,1-8H3,(H2,98,129)(H2,99,130)(H2,100,131)(H,107,112)(H,111,138)(H,113,132)(H,114,145)(H,115,136)(H,116,139)(H,117,143)(H,118,146)(H,119,140)(H,120,147)(H,121,149)(H,122,135)(H,123,137)(H,124,141)(H,125,150)(H,126,142)(H,127,144)(H,128,148)(H,133,134)(H,151,152)(H4,101,102,108)(H4,103,104,109)(H4,105,106,110)/t50-,51-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,72-,73-/m0/s1
InChI key:NHCJMYZDRROLEW-OFXZVSIYSA-N
SMILES:C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC1=CNC=N1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)N)C(=O)O)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](C)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CCCNC(=N)N)N
Synonyms:
  • Protein Kinase C (19-36)
  • H-Arg-Phe-Ala-Arg-Lys-Gly-Ala-Leu-Arg-Gln-Lys-Asn-Val-His-Glu-Val-Lys-Asn-OH
Found 5 products.