CymitQuimica logo

CAS 1137576-38-5

:

4,6-dichloro-5-iodopyrimidine

Description:
4,6-Dichloro-5-iodopyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms and one iodine atom. The presence of these halogen substituents significantly influences its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate to high polarity due to the electronegative halogens, which can also enhance their solubility in polar solvents. The compound is likely to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its structure suggests potential applications in medicinal chemistry, where halogenated pyrimidines are often explored for their biological activity. Additionally, the compound's stability under standard conditions is generally good, although it may be sensitive to strong bases or nucleophiles. Safety precautions should be taken when handling this compound, as halogenated organic compounds can pose health risks and environmental concerns.
Formula:C4HCl2IN2
InChI:InChI=1S/C4HCl2IN2/c5-3-2(7)4(6)9-1-8-3/h1H
InChI key:YKSZLCOPANWXES-UHFFFAOYSA-N
SMILES:C1=NC(=C(C(=N1)Cl)I)Cl
Found 4 products.