CymitQuimica logo

CAS 1137608-69-5

:

LX 1606 hippurate

Description:
LX 1606 hippurate, identified by its CAS number 1137608-69-5, is a chemical compound that has garnered interest in pharmaceutical research, particularly for its potential therapeutic applications. As a derivative of hippuric acid, it typically exhibits characteristics associated with both its structural components and functional groups. The compound is likely to be soluble in polar solvents due to the presence of carboxylate groups, which can engage in hydrogen bonding. LX 1606 hippurate may also demonstrate specific biological activity, potentially influencing metabolic pathways or exhibiting effects on certain biological targets. Its stability, reactivity, and interaction with biological systems would be influenced by its molecular structure, including any substituents that may affect its pharmacokinetics and pharmacodynamics. As with many compounds in drug development, understanding its safety profile, efficacy, and mechanism of action is crucial for evaluating its potential use in clinical settings. Further research and characterization would be necessary to fully elucidate its properties and applications.
Formula:C36H35ClF3N7O6
InChI:InChI=1S/C27H26ClF3N6O3.C9H9NO3/c1-3-39-25(38)20(32)12-16-4-6-17(7-5-16)21-14-23(35-26(33)34-21)40-24(27(29,30)31)19-9-8-18(28)13-22(19)37-11-10-15(2)36-37;11-8(12)6-10-9(13)7-4-2-1-3-5-7/h4-11,13-14,20,24H,3,12,32H2,1-2H3,(H2,33,34,35);1-5H,6H2,(H,10,13)(H,11,12)/t20-,24+;/m0./s1
InChI key:XSFPZBUIBYMVEA-CELUQASASA-N
SMILES:CCOC(=O)[C@H](CC1=CC=C(C=C1)C2=CC(=NC(=N2)N)O[C@H](C3=C(C=C(C=C3)Cl)N4C=CC(=N4)C)C(F)(F)F)N.C1=CC=C(C=C1)C(=O)NCC(=O)O
Found 5 products.