CymitQuimica logo

CAS 1137622-03-7

:

5-Amino-2-methoxybenzaldehyde

Description:
5-Amino-2-methoxybenzaldehyde is an organic compound characterized by the presence of an amino group (-NH2) and a methoxy group (-OCH3) attached to a benzaldehyde structure. This compound features a benzene ring with a formyl group (-CHO) at one position and an amino group at the fifth position, while the methoxy group is located at the second position of the ring. It is typically a pale yellow to light brown solid, soluble in organic solvents, and exhibits moderate polarity due to the functional groups present. The amino group can participate in hydrogen bonding, enhancing its reactivity in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interaction with other chemical species. This compound may find applications in organic synthesis, pharmaceuticals, and as an intermediate in the preparation of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-11-8-3-2-7(9)4-6(8)5-10/h2-5H,9H2,1H3
InChI key:InChIKey=WAMMZSZYLBQHBC-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=O)C=C(N)C=C1
Synonyms:
  • Benzaldehyde, 5-amino-2-methoxy-
  • 5-Amino-2-methoxybenzaldehyde
Found 2 products.