CymitQuimica logo

CAS 1137826-05-1

:

6-hydroxyquinoline-3-carboxylic acid

Description:
6-Hydroxyquinoline-3-carboxylic acid is an organic compound characterized by its quinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound possesses both hydroxyl (-OH) and carboxylic acid (-COOH) functional groups, contributing to its acidic properties and potential for hydrogen bonding. The presence of the hydroxyl group at the 6-position and the carboxylic acid at the 3-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a ligand in coordination chemistry. Its ability to chelate metal ions can be particularly useful in catalysis and analytical chemistry. Additionally, the structural features of 6-hydroxyquinoline-3-carboxylic acid may impart unique optical properties, making it a candidate for studies in photochemistry and fluorescence. Overall, its diverse functional groups and structural characteristics make it a valuable compound for research and application.
Formula:C10H7NO3
InChI:InChI=1S/C10H7NO3/c12-8-1-2-9-6(4-8)3-7(5-11-9)10(13)14/h1-5,12H,(H,13,14)
InChI key:OKIIDYYKVMNMGL-UHFFFAOYSA-N
SMILES:C1=CC2=NC=C(C=C2C=C1O)C(=O)O
Synonyms:
  • 3-Quinolinecarboxylic acid, 6-hydroxy-
  • 6-hydroxyquinoline-3-carboxylic acid
Found 4 products.