CymitQuimica logo

CAS 1137868-52-0

:

TAK-960

Description:
TAK-960, identified by its CAS number 1137868-52-0, is a chemical compound that has garnered attention in pharmaceutical research, particularly for its potential therapeutic applications. It is classified as a selective inhibitor of certain protein kinases, which play crucial roles in various cellular processes, including cell growth, differentiation, and metabolism. The compound's mechanism of action typically involves the modulation of signaling pathways associated with cancer and other diseases, making it a candidate for targeted therapies. TAK-960 is characterized by its specific binding affinity to its target kinases, which can lead to reduced activity of these proteins and subsequent effects on tumor cell proliferation. Additionally, its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are critical for determining its efficacy and safety profile in clinical settings. Ongoing research aims to further elucidate its biological effects and potential applications in treating specific types of cancer or other conditions influenced by kinase activity.
Formula:C27H34F3N7O3
InChI:InChI=1S/C27H34F3N7O3/c1-35-10-8-16(9-11-35)32-24(38)18-12-22(40-3)20(13-19(18)28)33-26-31-14-21-23(34-26)37(17-6-4-5-7-17)15-27(29,30)25(39)36(21)2/h12-14,16-17H,4-11,15H2,1-3H3,(H,32,38)(H,31,33,34)
InChI key:GWRSATNRNFYMDI-UHFFFAOYSA-N
SMILES:CN1CCC(CC1)NC(=O)C2=CC(=C(C=C2F)NC3=NC=C4C(=N3)N(CC(C(=O)N4C)(F)F)C5CCCC5)OC
Found 8 products.