CAS 113798-74-6
:2,3,6-TRIFLUOROPHENOL
Description:
2,3,6-Trifluorophenol is an aromatic compound characterized by the presence of three fluorine atoms substituted on a phenolic ring. Its molecular structure features a hydroxyl group (-OH) attached to a benzene ring, which is further substituted at the 2, 3, and 6 positions with fluorine atoms. This trifluorination significantly influences its chemical properties, including increased acidity compared to non-fluorinated phenols due to the electron-withdrawing nature of the fluorine atoms. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits moderate solubility in polar solvents and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Due to its unique properties, 2,3,6-trifluorophenol is of interest in various fields, including pharmaceuticals and materials science, where it may serve as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H3F3O
InChI:InChI=1/C6H3F3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H
SMILES:c1cc(c(c(c1F)F)O)F
Synonyms:- Phenol, 2,3,6-trifluoro- (9CI)
- 2,3,6-Trifluorophenol 98%
- 2,3,6-Trifluorophenol98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3,6-Trifluorophenol, 98%
CAS:2,3,6-Trifluorophenol may be employed as model compound to investigate the site-selective functionalization of halogen-bearing phenols by organometallic approach. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label infoFormula:C6H3F3OPurity:98%Color and Shape:Fused solid or lumpy powder, White to creamMolecular weight:148.092,3,6-Trifluorophenol
CAS:Formula:C6H3F3OPurity:>95.0%(GC)(T)Color and Shape:White or Colorless to Yellow to Orange powder to lump to clear liquidMolecular weight:148.082,3,6-Trifluorophenol
CAS:2,3,6-TrifluorophenolFormula:C6H3F3OPurity:98%Color and Shape: light brown fused solidMolecular weight:148.08g/mol





