CymitQuimica logo

CAS 113798-74-6

:

2,3,6-TRIFLUOROPHENOL

Description:
2,3,6-Trifluorophenol is an aromatic compound characterized by the presence of three fluorine atoms substituted on a phenolic ring. Its molecular structure features a hydroxyl group (-OH) attached to a benzene ring, which is further substituted at the 2, 3, and 6 positions with fluorine atoms. This trifluorination significantly influences its chemical properties, including increased acidity compared to non-fluorinated phenols due to the electron-withdrawing nature of the fluorine atoms. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits moderate solubility in polar solvents and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Due to its unique properties, 2,3,6-trifluorophenol is of interest in various fields, including pharmaceuticals and materials science, where it may serve as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H3F3O
InChI:InChI=1/C6H3F3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H
InChI key:QSFGUSFDWCVXNR-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1F)F)O)F
Synonyms:
  • Phenol, 2,3,6-trifluoro- (9CI)
  • 2,3,6-Trifluorophenol 98%
  • 2,3,6-Trifluorophenol98%
Found 7 products.